C32H34N4O3 — CID 51620732
(3S)-3-(4-benzhydrylpiperazin-1-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 51620732) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is (3S)-3-(4-benzhydrylpiperazin-1-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(4-benzhydrylpiperazin-1-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51620732 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | (3S)-3-(4-benzhydrylpiperazin-1-yl)-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCN(C(c3ccccc3)c3ccccc3)CC2)C(=O)N1Cc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C32H34N4O3/c37-29-12-7-17-35(29)27-15-13-24(14-16-27)23-36-30(38)22-28(32(36)39)33-18-20-34(21-19-33)31(25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-11,13-16,28,31H,7,12,17-23H2/t28-/m0/s1 |
| InChIKey | JALSWMOMPNKHAI-NDEPHWFRSA-N |
| XLogP | 3.85 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|