C24H27ClN4O — CID 51634332
2-[(2S)-1-benzyl-4-[[2-(4-chlorophenyl)pyrimidin-5-yl]methyl]piperazin-2-yl]ethanol (PubChem CID 51634332) has the molecular formula C24H27ClN4O and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-[(2S)-1-benzyl-4-[[2-(4-chlorophenyl)pyrimidin-5-yl]methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-benzyl-4-[[2-(4-chlorophenyl)pyrimidin-5-yl]methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51634332 |
| Molecular Formula | C24H27ClN4O |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[(2S)-1-benzyl-4-[[2-(4-chlorophenyl)pyrimidin-5-yl]methyl]piperazin-2-yl]ethanol |
| SMILES | OCC[C@H]1CN(Cc2cnc(-c3ccc(Cl)cc3)nc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H27ClN4O/c25-22-8-6-21(7-9-22)24-26-14-20(15-27-24)16-28-11-12-29(23(18-28)10-13-30)17-19-4-2-1-3-5-19/h1-9,14-15,23,30H,10-13,16-18H2/t23-/m0/s1 |
| InChIKey | ABXUNKFPSUJBEL-QHCPKHFHSA-N |
| XLogP | 3.87 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |