C23H33N3O — CID 51636089
2-[(2S)-4-[[4-(N-methylanilino)phenyl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol (PubChem CID 51636089) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-[(2S)-4-[[4-(N-methylanilino)phenyl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[[4-(N-methylanilino)phenyl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51636089 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 2-[(2S)-4-[[4-(N-methylanilino)phenyl]methyl]-1-propan-2-ylpiperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCN(Cc2ccc(N(C)c3ccccc3)cc2)C[C@@H]1CCO |
| InChI | InChI=1S/C23H33N3O/c1-19(2)26-15-14-25(18-23(26)13-16-27)17-20-9-11-22(12-10-20)24(3)21-7-5-4-6-8-21/h4-12,19,23,27H,13-18H2,1-3H3/t23-/m0/s1 |
| InChIKey | MICNLUMOVGBWHU-QHCPKHFHSA-N |
| XLogP | 3.73 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |