C23H26N2O5 — CID 51643658
trans-(3-nitrophenyl)methyl (1R,2R)-2-[(4-ethylphenyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 51643658) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is trans-(3-nitrophenyl)methyl (1R,2R)-2-[(4-ethylphenyl)carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(3-nitrophenyl)methyl (1R,2R)-2-[(4-ethylphenyl)carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 51643658 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | trans-(3-nitrophenyl)methyl (1R,2R)-2-[(4-ethylphenyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCc1ccc(NC(=O)[C@@H]2CCCC[C@H]2C(=O)OCc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-2-16-10-12-18(13-11-16)24-22(26)20-8-3-4-9-21(20)23(27)30-15-17-6-5-7-19(14-17)25(28)29/h5-7,10-14,20-21H,2-4,8-9,15H2,1H3,(H,24,26)/t20-,21-/m1/s1 |
| InChIKey | IZUCGDDHQMDCNZ-NHCUHLMSSA-N |
| XLogP | 4.65 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|