C22H25FN2O6 — CID 51654904
(3R)-N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 51654904) has the molecular formula C22H25FN2O6 and a molecular weight of 432.45 g/mol. Its IUPAC name is (3R)-N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51654904 |
| Molecular Formula | C22H25FN2O6 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (3R)-N-[2-(2-fluorophenoxy)ethyl]-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(N2C[C@H](C(=O)NCCOc3ccccc3F)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H25FN2O6/c1-28-18-11-15(12-19(29-2)21(18)30-3)25-13-14(10-20(25)26)22(27)24-8-9-31-17-7-5-4-6-16(17)23/h4-7,11-12,14H,8-10,13H2,1-3H3,(H,24,27)/t14-/m1/s1 |
| InChIKey | SNINHNLHSBKLGR-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|