C28H35N3O4 — CID 51668480
(1R,2S,5S,6R,7S)-2-N-benzyl-7-methyl-6-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 51668480) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-2-N-benzyl-7-methyl-6-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5S,6R,7S)-2-N-benzyl-7-methyl-6-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 51668480 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (1R,2S,5S,6R,7S)-2-N-benzyl-7-methyl-6-N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-prop-2-enyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C=CCN1C(=O)[C@H]2[C@@H](C(=O)N[C@@H]3CCCC[C@H]3C)[C@]3(C)C=C[C@]2(O3)[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-16-31-23(25(33)29-17-19-11-6-5-7-12-19)28-15-14-27(3,35-28)21(22(28)26(31)34)24(32)30-20-13-9-8-10-18(20)2/h4-7,11-12,14-15,18,20-23H,1,8-10,13,16-17H2,2-3H3,(H,29,33)(H,30,32)/t18-,20-,21+,22-,23-,27+,28-/m1/s1 |
| InChIKey | HHMWXHFPVQMVCO-XUTCNDPTSA-N |
| XLogP | 2.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|