C19H22O — CID 5169021
4-butyl-4-phenyl-2,3-dihydrochromene (PubChem CID 5169021) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-butyl-4-phenyl-2,3-dihydrochromene.
| Compound Name | 4-butyl-4-phenyl-2,3-dihydrochromene |
|---|---|
| PubChem CID | 5169021 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-butyl-4-phenyl-2,3-dihydrochromene |
| SMILES | CCCCC1(c2ccccc2)CCOc2ccccc21 |
| InChI | InChI=1S/C19H22O/c1-2-3-13-19(16-9-5-4-6-10-16)14-15-20-18-12-8-7-11-17(18)19/h4-12H,2-3,13-15H2,1H3 |
| InChIKey | RNYCICHDKHFEOT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |