C23H18N4O3S — CID 51700908
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-methyl-3-(4-phenyl-1,3-thiazol-2-yl)imidazol-4-yl]prop-2-enamide (PubChem CID 51700908) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-methyl-3-(4-phenyl-1,3-thiazol-2-yl)imidazol-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-methyl-3-(4-phenyl-1,3-thiazol-2-yl)imidazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 51700908 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-methyl-3-(4-phenyl-1,3-thiazol-2-yl)imidazol-4-yl]prop-2-enamide |
| SMILES | Cc1ncc(NC(=O)/C=C/c2ccc3c(c2)OCO3)n1-c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H18N4O3S/c1-15-24-12-21(27(15)23-25-18(13-31-23)17-5-3-2-4-6-17)26-22(28)10-8-16-7-9-19-20(11-16)30-14-29-19/h2-13H,14H2,1H3,(H,26,28)/b10-8+ |
| InChIKey | IEBFXPVPEDBNNK-CSKARUKUSA-N |
| XLogP | 4.68 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|