C19H15BrN2O5 — CID 51705405
(1R,3R,3aS,6aR)-5-(3-bromophenyl)-1-(2-hydroxyphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 51705405) has the molecular formula C19H15BrN2O5 and a molecular weight of 431.24 g/mol. Its IUPAC name is (1R,3R,3aS,6aR)-5-(3-bromophenyl)-1-(2-hydroxyphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (1R,3R,3aS,6aR)-5-(3-bromophenyl)-1-(2-hydroxyphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 51705405 |
| Molecular Formula | C19H15BrN2O5 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (1R,3R,3aS,6aR)-5-(3-bromophenyl)-1-(2-hydroxyphenyl)-4,6-dioxo-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1N[C@@H](c2ccccc2O)[C@@H]2C(=O)N(c3cccc(Br)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C19H15BrN2O5/c20-9-4-3-5-10(8-9)22-17(24)13-14(18(22)25)16(19(26)27)21-15(13)11-6-1-2-7-12(11)23/h1-8,13-16,21,23H,(H,26,27)/t13-,14+,15+,16-/m1/s1 |
| InChIKey | UXPNNSRPGORKSY-FXUDXRNXSA-N |
| XLogP | 2.06 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|