C25H19N5O5 — CID 51705718
(1R,2R,3S,8aR)-1,6-dicyano-3-(4-methoxybenzoyl)-2-(3-nitrophenyl)-3,8a-dihydro-2H-indolizine-1-carboxamide (PubChem CID 51705718) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is (1R,2R,3S,8aR)-1,6-dicyano-3-(4-methoxybenzoyl)-2-(3-nitrophenyl)-3,8a-dihydro-2H-indolizine-1-carboxamide.
| Compound Name | (1R,2R,3S,8aR)-1,6-dicyano-3-(4-methoxybenzoyl)-2-(3-nitrophenyl)-3,8a-dihydro-2H-indolizine-1-carboxamide |
|---|---|
| PubChem CID | 51705718 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (1R,2R,3S,8aR)-1,6-dicyano-3-(4-methoxybenzoyl)-2-(3-nitrophenyl)-3,8a-dihydro-2H-indolizine-1-carboxamide |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H](c3cccc([N+](=O)[O-])c3)[C@@](C#N)(C(N)=O)[C@H]3C=CC(C#N)=CN23)cc1 |
| InChI | InChI=1S/C25H19N5O5/c1-35-19-8-6-16(7-9-19)23(31)22-21(17-3-2-4-18(11-17)30(33)34)25(14-27,24(28)32)20-10-5-15(12-26)13-29(20)22/h2-11,13,20-22H,1H3,(H2,28,32)/t20-,21+,22+,25+/m1/s1 |
| InChIKey | ATDDEBYZFBSWIX-KXEAFHOWSA-N |
| XLogP | 2.60 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|