C24H19N3O6 — CID 51706703
N-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-4-nitro-N-phenacylbenzamide (PubChem CID 51706703) has the molecular formula C24H19N3O6 and a molecular weight of 445.43 g/mol. Its IUPAC name is N-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-4-nitro-N-phenacylbenzamide.
| Compound Name | N-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-4-nitro-N-phenacylbenzamide |
|---|---|
| PubChem CID | 51706703 |
| Molecular Formula | C24H19N3O6 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-4-nitro-N-phenacylbenzamide |
| SMILES | O=C(CN(C(=O)c1ccc([N+](=O)[O-])cc1)N1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O6/c28-19(14-4-2-1-3-5-14)13-25(22(29)15-8-10-18(11-9-15)27(32)33)26-23(30)20-16-6-7-17(12-16)21(20)24(26)31/h1-11,16-17,20-21H,12-13H2/t16-,17+,20-,21+ |
| InChIKey | KCZSTMOPZYQNSH-ALFLXDJESA-N |
| XLogP | 2.64 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|