C24H17Cl2N3O6 — CID 6554587
2,4-dichloro-N-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-(4-nitrophenyl)-2-oxoethyl]benzamide (PubChem CID 6554587) has the molecular formula C24H17Cl2N3O6 and a molecular weight of 514.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-(4-nitrophenyl)-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-(4-nitrophenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 6554587 |
| Molecular Formula | C24H17Cl2N3O6 |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 2,4-dichloro-N-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-(4-nitrophenyl)-2-oxoethyl]benzamide |
| SMILES | O=C(CN(C(=O)c1ccc(Cl)cc1Cl)N1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17Cl2N3O6/c25-15-5-8-17(18(26)10-15)22(31)27(11-19(30)12-3-6-16(7-4-12)29(34)35)28-23(32)20-13-1-2-14(9-13)21(20)24(28)33/h1-8,10,13-14,20-21H,9,11H2/t13-,14+,20-,21-/m0/s1 |
| InChIKey | SZEMWBRBZWPWAL-ZVLVQXPOSA-N |
| XLogP | 3.95 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|