C23H17Cl3N2O3 — CID 124558229
4-chloro-N-[(3,4-dichlorophenyl)methyl]-N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide (PubChem CID 124558229) has the molecular formula C23H17Cl3N2O3 and a molecular weight of 475.76 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-dichlorophenyl)methyl]-N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide.
| Compound Name | 4-chloro-N-[(3,4-dichlorophenyl)methyl]-N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
|---|---|
| PubChem CID | 124558229 |
| Molecular Formula | C23H17Cl3N2O3 |
| Molecular Weight | 475.76 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 4-chloro-N-[(3,4-dichlorophenyl)methyl]-N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(Cc1ccc(Cl)c(Cl)c1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H17Cl3N2O3/c24-16-6-4-13(5-7-16)21(29)27(11-12-1-8-17(25)18(26)9-12)28-22(30)19-14-2-3-15(10-14)20(19)23(28)31/h1-9,14-15,19-20H,10-11H2/t14-,15-,19-,20+/m0/s1 |
| InChIKey | ULRCRNDUJWDAPQ-HZVDNRATSA-N |
| XLogP | 5.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|