C27H22Cl2N2O4 — CID 98107099
3,4-dichloro-N-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(4-methylphenyl)-2-oxoethyl]benzamide (PubChem CID 98107099) has the molecular formula C27H22Cl2N2O4 and a molecular weight of 509.39 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(4-methylphenyl)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(4-methylphenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 98107099 |
| Molecular Formula | C27H22Cl2N2O4 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(4-methylphenyl)-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(C(=O)CN(C(=O)c2ccc(Cl)c(Cl)c2)N2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@H]5C[C@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O4/c1-13-2-4-14(5-3-13)22(32)12-30(25(33)15-6-9-20(28)21(29)10-15)31-26(34)23-16-7-8-17(19-11-18(16)19)24(23)27(31)35/h2-10,16-19,23-24H,11-12H2,1H3/t16-,17-,18-,19-,23-,24+/m1/s1 |
| InChIKey | OWCWMOYRZUFRIP-MEAHRRIZSA-N |
| XLogP | 4.60 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|