C24H19BrCl2N2O4 — CID 98107086
N-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(4-bromophenyl)-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 98107086) has the molecular formula C24H19BrCl2N2O4 and a molecular weight of 550.24 g/mol. Its IUPAC name is N-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(4-bromophenyl)-2-oxoethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(4-bromophenyl)-2-oxoethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 98107086 |
| Molecular Formula | C24H19BrCl2N2O4 |
| Molecular Weight | 550.24 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | N-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[2-(4-bromophenyl)-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | C[C@H]1C=CC[C@@H]2C(=O)N(N(CC(=O)c3ccc(Br)cc3)C(=O)c3ccc(Cl)c(Cl)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C24H19BrCl2N2O4/c1-13-3-2-4-17-21(13)24(33)29(23(17)32)28(12-20(30)14-5-8-16(25)9-6-14)22(31)15-7-10-18(26)19(27)11-15/h2-3,5-11,13,17,21H,4,12H2,1H3/t13-,17-,21+/m0/s1 |
| InChIKey | TWHFISKCPZPPIL-IBNJYYFUSA-N |
| XLogP | 5.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|