C24H20Cl2N2O4 — CID 92543088
N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3,4-dichloro-N-phenacylbenzamide (PubChem CID 92543088) has the molecular formula C24H20Cl2N2O4 and a molecular weight of 471.34 g/mol. Its IUPAC name is N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3,4-dichloro-N-phenacylbenzamide.
| Compound Name | N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3,4-dichloro-N-phenacylbenzamide |
|---|---|
| PubChem CID | 92543088 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-3,4-dichloro-N-phenacylbenzamide |
| SMILES | C[C@@H]1C=CC[C@H]2C(=O)N(N(CC(=O)c3ccccc3)C(=O)c3ccc(Cl)c(Cl)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H20Cl2N2O4/c1-14-6-5-9-17-21(14)24(32)28(23(17)31)27(13-20(29)15-7-3-2-4-8-15)22(30)16-10-11-18(25)19(26)12-16/h2-8,10-12,14,17,21H,9,13H2,1H3/t14-,17-,21-/m1/s1 |
| InChIKey | NCHVITJWMLTAOS-SOIKWTOOSA-N |
| XLogP | 4.43 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|