C23H20Cl2N2O3 — CID 124579111
N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[(2-chlorophenyl)methyl]benzamide (PubChem CID 124579111) has the molecular formula C23H20Cl2N2O3 and a molecular weight of 443.33 g/mol. Its IUPAC name is N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[(2-chlorophenyl)methyl]benzamide.
| Compound Name | N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[(2-chlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 124579111 |
| Molecular Formula | C23H20Cl2N2O3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[(3aR,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[(2-chlorophenyl)methyl]benzamide |
| SMILES | C[C@@H]1C=CC[C@H]2C(=O)N(N(Cc3ccccc3Cl)C(=O)c3ccccc3Cl)C(=O)[C@H]12 |
| InChI | InChI=1S/C23H20Cl2N2O3/c1-14-7-6-10-17-20(14)23(30)27(22(17)29)26(13-15-8-2-4-11-18(15)24)21(28)16-9-3-5-12-19(16)25/h2-9,11-12,14,17,20H,10,13H2,1H3/t14-,17-,20-/m1/s1 |
| InChIKey | OMQZPSYCJZKNHW-WIBUTAKZSA-N |
| XLogP | 4.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|