C23H17Cl3N2O4 — CID 28985059
N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[2-(2,4-dichlorophenyl)-2-oxoethyl]benzamide (PubChem CID 28985059) has the molecular formula C23H17Cl3N2O4 and a molecular weight of 491.76 g/mol. Its IUPAC name is N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[2-(2,4-dichlorophenyl)-2-oxoethyl]benzamide.
| Compound Name | N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[2-(2,4-dichlorophenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 28985059 |
| Molecular Formula | C23H17Cl3N2O4 |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | N-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-2-chloro-N-[2-(2,4-dichlorophenyl)-2-oxoethyl]benzamide |
| SMILES | O=C(CN(C(=O)c1ccccc1Cl)N1C(=O)[C@H]2CC=CC[C@H]2C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl3N2O4/c24-13-9-10-16(19(26)11-13)20(29)12-27(21(30)17-7-3-4-8-18(17)25)28-22(31)14-5-1-2-6-15(14)23(28)32/h1-4,7-11,14-15H,5-6,12H2/t14-,15+ |
| InChIKey | MUSLNZNEZJOQQY-GASCZTMLSA-N |
| XLogP | 4.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|