C23H19Cl2FN2O4 — CID 124558214
N-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-[2-(4-fluorophenyl)-2-oxoethyl]benzamide (PubChem CID 124558214) has the molecular formula C23H19Cl2FN2O4 and a molecular weight of 477.32 g/mol. Its IUPAC name is N-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-[2-(4-fluorophenyl)-2-oxoethyl]benzamide.
| Compound Name | N-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-[2-(4-fluorophenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 124558214 |
| Molecular Formula | C23H19Cl2FN2O4 |
| Molecular Weight | 477.32 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-[2-(4-fluorophenyl)-2-oxoethyl]benzamide |
| SMILES | O=C(CN(C(=O)c1ccc(Cl)cc1Cl)N1C(=O)[C@H]2CCCC[C@H]2C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19Cl2FN2O4/c24-14-7-10-18(19(25)11-14)21(30)27(12-20(29)13-5-8-15(26)9-6-13)28-22(31)16-3-1-2-4-17(16)23(28)32/h5-11,16-17H,1-4,12H2/t16-,17+ |
| InChIKey | XYPGDRHWSVLDMD-CALCHBBNSA-N |
| XLogP | 4.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|