C21H18Cl2N2O4S — CID 2301851
N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-(2-oxo-2-thiophen-2-ylethyl)benzamide (PubChem CID 2301851) has the molecular formula C21H18Cl2N2O4S and a molecular weight of 465.36 g/mol. Its IUPAC name is N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-(2-oxo-2-thiophen-2-ylethyl)benzamide.
| Compound Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-(2-oxo-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 2301851 |
| Molecular Formula | C21H18Cl2N2O4S |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2,4-dichloro-N-(2-oxo-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(CN(C(=O)c1ccc(Cl)cc1Cl)N1C(=O)[C@@H]2CCCC[C@H]2C1=O)c1cccs1 |
| InChI | InChI=1S/C21H18Cl2N2O4S/c22-12-7-8-15(16(23)10-12)19(27)24(11-17(26)18-6-3-9-30-18)25-20(28)13-4-1-2-5-14(13)21(25)29/h3,6-10,13-14H,1-2,4-5,11H2/t13-,14-/m1/s1 |
| InChIKey | HEYKRGUQMNOOPC-ZIAGYGMSSA-N |
| XLogP | 4.47 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|