C22H20ClFN2O3 — CID 7366957
N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-chloro-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 7366957) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-chloro-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-chloro-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 7366957 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-chloro-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1ccccc1F)N1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C22H20ClFN2O3/c23-18-11-5-4-10-17(18)20(27)25(13-14-7-1-6-12-19(14)24)26-21(28)15-8-2-3-9-16(15)22(26)29/h1,4-7,10-12,15-16H,2-3,8-9,13H2/t15-,16-/m1/s1 |
| InChIKey | UEJWVIWQDFFEKN-HZPDHXFCSA-N |
| XLogP | 4.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|