C26H19Cl2N3O6 — CID 100808169
3,4-dichloro-N-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(3-nitrophenyl)-2-oxoethyl]benzamide (PubChem CID 100808169) has the molecular formula C26H19Cl2N3O6 and a molecular weight of 540.36 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(3-nitrophenyl)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(3-nitrophenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 100808169 |
| Molecular Formula | C26H19Cl2N3O6 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 3,4-dichloro-N-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[2-(3-nitrophenyl)-2-oxoethyl]benzamide |
| SMILES | O=C(CN(C(=O)c1ccc(Cl)c(Cl)c1)N1C(=O)[C@@H]2[C@@H]3C=C[C@H]([C@@H]4C[C@H]34)[C@@H]2C1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H19Cl2N3O6/c27-19-7-4-13(9-20(19)28)24(33)29(11-21(32)12-2-1-3-14(8-12)31(36)37)30-25(34)22-15-5-6-16(18-10-17(15)18)23(22)26(30)35/h1-9,15-18,22-23H,10-11H2/t15-,16-,17-,18+,22-,23+/m1/s1 |
| InChIKey | WSKQVVGNMZFBIX-TZQJRMFESA-N |
| XLogP | 4.19 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|