C20H28N2S — CID 5170710
1-(naphthalen-1-ylmethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 5170710) has the molecular formula C20H28N2S and a molecular weight of 328.52 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-(naphthalen-1-ylmethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 5170710 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | CC(C)(C)CC(C)(C)NC(=S)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H28N2S/c1-19(2,3)14-20(4,5)22-18(23)21-13-16-11-8-10-15-9-6-7-12-17(15)16/h6-12H,13-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | CEMVYNJOUZEIGJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|