C12H20Cl2N2O2 — CID 51726123
(1S)-N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide (PubChem CID 51726123) has the molecular formula C12H20Cl2N2O2 and a molecular weight of 295.21 g/mol. Its IUPAC name is (1S)-N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51726123 |
| Molecular Formula | C12H20Cl2N2O2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (1S)-N-[2-(tert-butylamino)-2-oxoethyl]-2,2-dichloro-N,1-dimethylcyclopropane-1-carboxamide |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C12H20Cl2N2O2/c1-10(2,3)15-8(17)6-16(5)9(18)11(4)7-12(11,13)14/h6-7H2,1-5H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | YXUSGBPJQDHWHM-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|