C20H21NO3 — CID 51729980
(2S,3R)-2-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 51729980) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2S,3R)-2-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (2S,3R)-2-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 51729980 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S,3R)-2-methyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | C[C@@H]1Oc2ccccc2O[C@H]1C(=O)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H21NO3/c1-13-19(24-18-12-5-4-11-17(18)23-13)20(22)21-16-10-6-8-14-7-2-3-9-15(14)16/h2-5,7,9,11-13,16,19H,6,8,10H2,1H3,(H,21,22)/t13-,16-,19+/m0/s1 |
| InChIKey | PTXWFKNFADOQRV-IYJAJMOOSA-N |
| XLogP | 3.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |