C21H25N3O3 — CID 51730149
(2S)-2-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 51730149) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 51730149 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2S)-2-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@H](c1ccccc1)N1CCC[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-22-21(26)23-20(25)19(16-7-4-3-5-8-16)24-14-6-9-18(24)15-10-12-17(27-2)13-11-15/h3-5,7-8,10-13,18-19H,6,9,14H2,1-2H3,(H2,22,23,25,26)/t18-,19-/m0/s1 |
| InChIKey | FGRRYILPFHMNJX-OALUTQOASA-N |
| XLogP | 3.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |