C17H19N3O2S — CID 94452155
(2S)-N-carbamoyl-2-phenyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide (PubChem CID 94452155) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-phenyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide.
| Compound Name | (2S)-N-carbamoyl-2-phenyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 94452155 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2S)-N-carbamoyl-2-phenyl-2-[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]acetamide |
| SMILES | NC(=O)NC(=O)[C@H](c1ccccc1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C17H19N3O2S/c18-17(22)19-16(21)15(12-5-2-1-3-6-12)20-9-4-7-14(20)13-8-10-23-11-13/h1-3,5-6,8,10-11,14-15H,4,7,9H2,(H3,18,19,21,22)/t14-,15+/m1/s1 |
| InChIKey | YJVWHLLNKPGNAO-CABCVRRESA-N |
| XLogP | 2.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |