C18H20N2O3 — CID 5173123
3-hydroxy-2-(2-methoxyphenyl)-4,4-dimethyl-1-oxido-5-phenyl-2H-imidazol-1-ium (PubChem CID 5173123) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-hydroxy-2-(2-methoxyphenyl)-4,4-dimethyl-1-oxido-5-phenyl-2H-imidazol-1-ium.
| Compound Name | 3-hydroxy-2-(2-methoxyphenyl)-4,4-dimethyl-1-oxido-5-phenyl-2H-imidazol-1-ium |
|---|---|
| PubChem CID | 5173123 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-hydroxy-2-(2-methoxyphenyl)-4,4-dimethyl-1-oxido-5-phenyl-2H-imidazol-1-ium |
| SMILES | COc1ccccc1C1N(O)C(C)(C)C(c2ccccc2)=[N+]1[O-] |
| InChI | InChI=1S/C18H20N2O3/c1-18(2)16(13-9-5-4-6-10-13)19(21)17(20(18)22)14-11-7-8-12-15(14)23-3/h4-12,17,22H,1-3H3 |
| InChIKey | KUTABYUABZUUCP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|