C20H20Cl2N3O+ — CID 5177048
3-(3,5-dichlorophenyl)imino-1-(piperidin-1-ium-1-ylmethyl)indol-2-one (PubChem CID 5177048) has the molecular formula C20H20Cl2N3O+ and a molecular weight of 389.31 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)imino-1-(piperidin-1-ium-1-ylmethyl)indol-2-one.
| Compound Name | 3-(3,5-dichlorophenyl)imino-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 5177048 |
| Molecular Formula | C20H20Cl2N3O+ |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-(3,5-dichlorophenyl)imino-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
| SMILES | O=C1/C(=N/c2cc(Cl)cc(Cl)c2)c2ccccc2N1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C20H19Cl2N3O/c21-14-10-15(22)12-16(11-14)23-19-17-6-2-3-7-18(17)25(20(19)26)13-24-8-4-1-5-9-24/h2-3,6-7,10-12H,1,4-5,8-9,13H2/p+1/b23-19+ |
| InChIKey | DUPNLDISSGFARS-FCDQGJHFSA-O |
| XLogP | 3.49 |
| TPSA | 37.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|