C24H20ClN3O — CID 589728
3-(4-chlorophenyl)imino-1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)indol-2-one (PubChem CID 589728) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)imino-1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)indol-2-one.
| Compound Name | 3-(4-chlorophenyl)imino-1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 589728 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-(4-chlorophenyl)imino-1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)indol-2-one |
| SMILES | O=C1/C(=N/c2ccc(Cl)cc2)c2ccccc2N1CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H20ClN3O/c25-19-9-11-20(12-10-19)26-23-21-7-3-4-8-22(21)28(24(23)29)16-27-14-13-17-5-1-2-6-18(17)15-27/h1-12H,13-16H2/b26-23+ |
| InChIKey | FOOKBEWCDODWMA-WNAAXNPUSA-N |
| XLogP | 4.82 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|