C19H24O2P+ — CID 5179038
2-carboxyethyl-ethyl-[(3-methylphenyl)methyl]-phenylphosphanium (PubChem CID 5179038) has the molecular formula C19H24O2P+ and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-carboxyethyl-ethyl-[(3-methylphenyl)methyl]-phenylphosphanium.
| Compound Name | 2-carboxyethyl-ethyl-[(3-methylphenyl)methyl]-phenylphosphanium |
|---|---|
| PubChem CID | 5179038 |
| Molecular Formula | C19H24O2P+ |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-carboxyethyl-ethyl-[(3-methylphenyl)methyl]-phenylphosphanium |
| SMILES | CC[P+](CCC(=O)O)(Cc1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C19H23O2P/c1-3-22(13-12-19(20)21,18-10-5-4-6-11-18)15-17-9-7-8-16(2)14-17/h4-11,14H,3,12-13,15H2,1-2H3/p+1 |
| InChIKey | OOJQNNQFYXHBRO-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|