C15H15Br2NO3S — CID 5181856
2-bromo-N-[2-(5-bromo-2-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 5181856) has the molecular formula C15H15Br2NO3S and a molecular weight of 449.16 g/mol. Its IUPAC name is 2-bromo-N-[2-(5-bromo-2-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(5-bromo-2-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5181856 |
| Molecular Formula | C15H15Br2NO3S |
| Molecular Weight | 449.16 g/mol |
| Exact Mass | 446.91 |
| IUPAC Name | 2-bromo-N-[2-(5-bromo-2-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1CCNS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C15H15Br2NO3S/c1-21-14-7-6-12(16)10-11(14)8-9-18-22(19,20)15-5-3-2-4-13(15)17/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | NQLJNNTUKDIVQY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.16 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |