C23H20F3NO3 — CID 5184301
3-[[3-(trifluoromethyl)phenyl]methyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one (PubChem CID 5184301) has the molecular formula C23H20F3NO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]methyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
|---|---|
| PubChem CID | 5184301 |
| Molecular Formula | C23H20F3NO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]methyl]-2,4,7,8,9,10-hexahydroisochromeno[3,4-f][1,3]benzoxazin-6-one |
| SMILES | O=c1oc2c3c(ccc2c2c1CCCC2)OCN(Cc1cccc(C(F)(F)F)c1)C3 |
| InChI | InChI=1S/C23H20F3NO3/c24-23(25,26)15-5-3-4-14(10-15)11-27-12-19-20(29-13-27)9-8-17-16-6-1-2-7-18(16)22(28)30-21(17)19/h3-5,8-10H,1-2,6-7,11-13H2 |
| InChIKey | AKUQWTYBRSJHOY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|