C23H27F3N4O5S — CID 5185963
N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide (PubChem CID 5185963) has the molecular formula C23H27F3N4O5S and a molecular weight of 528.55 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 5185963 |
| Molecular Formula | C23H27F3N4O5S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-[2-nitro-4-(trifluoromethyl)anilino]propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H27F3N4O5S/c1-15-7-9-18(14-21(15)36(34,35)29-11-5-3-4-6-12-29)28-22(31)16(2)27-19-10-8-17(23(24,25)26)13-20(19)30(32)33/h7-10,13-14,16,27H,3-6,11-12H2,1-2H3,(H,28,31) |
| InChIKey | SHHRYJFQLYARIE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|