C11H13NO3S — CID 51877530
N-[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]acetamide (PubChem CID 51877530) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]acetamide.
| Compound Name | N-[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 51877530 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C11H13NO3S/c1-8(13)12-10-6-7-16(14,15)11-5-3-2-4-9(10)11/h2-5,10H,6-7H2,1H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | FVJJKHMQRHXKHT-SNVBAGLBSA-N |
| XLogP | 1.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |