C16H23N3O4S — CID 94162037
N-[2-[[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]ethyl]-2-methylpropanamide (PubChem CID 94162037) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[2-[[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 94162037 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[2-[[(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)N[C@@H]1CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H23N3O4S/c1-11(2)15(20)17-8-9-18-16(21)19-13-7-10-24(22,23)14-6-4-3-5-12(13)14/h3-6,11,13H,7-10H2,1-2H3,(H,17,20)(H2,18,19,21)/t13-/m1/s1 |
| InChIKey | USQZCGHRARWJOH-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|