C10H13NS — CID 51885338
(4S)-6-methyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 51885338) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is (4S)-6-methyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | (4S)-6-methyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 51885338 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (4S)-6-methyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | Cc1ccc2c(c1)[C@@H](N)CCS2 |
| InChI | InChI=1S/C10H13NS/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,6,9H,4-5,11H2,1H3/t9-/m0/s1 |
| InChIKey | TZWIMFKGHRPBNI-VIFPVBQESA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |