About 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine
6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine (PubChem CID 105458273) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine.
Molecular Properties
| Compound Name | 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine |
| PubChem CID | 105458273 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine |
| SMILES | Cc1ccc2c(c1)C1(CCS2)CC1N |
| InChI | InChI=1S/C12H15NS/c1-8-2-3-10-9(6-8)12(4-5-14-10)7-11(12)13/h2-3,6,11H,4-5,7,13H2,1H3 |
| InChIKey | BYGXDLCGKQKEKW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine?
The IUPAC name of 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine (CID 105458273) is 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine.
What is the SMILES notation for 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine?
The canonical SMILES for 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine is Cc1ccc2c(c1)C1(CCS2)CC1N.
What is the InChIKey of 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine?
The InChIKey is BYGXDLCGKQKEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-8-2-3-10-9(6-8)12(4-5-14-10)7-11(12)13/h2-3,6,11H,4-5,7,13H2,1H3.
What are the key properties of 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine?
6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine has a molecular weight of 205.33 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylspiro[2,3-dihydrothiochromene-4,2'-cyclopropane]-1'-amine is sourced from PubChem (CID 105458273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).