C16H22S — CID 173298315
6-cyclopentyl-4,4-dimethyl-2,3-dihydrothiochromene (PubChem CID 173298315) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is 6-cyclopentyl-4,4-dimethyl-2,3-dihydrothiochromene.
| Compound Name | 6-cyclopentyl-4,4-dimethyl-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 173298315 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 6-cyclopentyl-4,4-dimethyl-2,3-dihydrothiochromene |
| SMILES | CC1(C)CCSc2ccc(C3CCCC3)cc21 |
| InChI | InChI=1S/C16H22S/c1-16(2)9-10-17-15-8-7-13(11-14(15)16)12-5-3-4-6-12/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | WAEMUFOQSSPVSI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |