C12H10ClF3N2O6 — CID 5188753
methyl 3-chloro-2-hydroxy-4-(3-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate (PubChem CID 5188753) has the molecular formula C12H10ClF3N2O6 and a molecular weight of 370.67 g/mol. Its IUPAC name is methyl 3-chloro-2-hydroxy-4-(3-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate.
| Compound Name | methyl 3-chloro-2-hydroxy-4-(3-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 5188753 |
| Molecular Formula | C12H10ClF3N2O6 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | methyl 3-chloro-2-hydroxy-4-(3-nitroanilino)-4-oxo-2-(trifluoromethyl)butanoate |
| SMILES | COC(=O)C(O)(C(Cl)C(=O)Nc1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2O6/c1-24-10(20)11(21,12(14,15)16)8(13)9(19)17-6-3-2-4-7(5-6)18(22)23/h2-5,8,21H,1H3,(H,17,19) |
| InChIKey | SLFTZGYYZGARBA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|