C10H19N3 — CID 51893143
(1R)-1-(1-tert-butyl-3-methylpyrazol-4-yl)ethanamine (PubChem CID 51893143) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (1R)-1-(1-tert-butyl-3-methylpyrazol-4-yl)ethanamine.
| Compound Name | (1R)-1-(1-tert-butyl-3-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 51893143 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (1R)-1-(1-tert-butyl-3-methylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C(C)(C)C)cc1[C@@H](C)N |
| InChI | InChI=1S/C10H19N3/c1-7(11)9-6-13(10(3,4)5)12-8(9)2/h6-7H,11H2,1-5H3/t7-/m1/s1 |
| InChIKey | FQUDDGOENFKEQS-SSDOTTSWSA-N |
| XLogP | 1.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |