C19H23NO5 — CID 51895170
(E)-3-(1,3-benzodioxol-5-yl)-N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]prop-2-enamide (PubChem CID 51895170) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 51895170 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NC[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C19H23NO5/c21-18(7-5-14-4-6-16-17(10-14)23-13-22-16)20-11-15-12-24-19(25-15)8-2-1-3-9-19/h4-7,10,15H,1-3,8-9,11-13H2,(H,20,21)/b7-5+/t15-/m0/s1 |
| InChIKey | KRQVXNFVGMDZMW-ZKKXHLJNSA-N |
| XLogP | 2.62 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|