C28H33FN6O — CID 51895934
1-(4-benzylpiperidin-1-yl)-3-[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propan-1-one (PubChem CID 51895934) has the molecular formula C28H33FN6O and a molecular weight of 488.61 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-3-[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propan-1-one.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-3-[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propan-1-one |
|---|---|
| PubChem CID | 51895934 |
| Molecular Formula | C28H33FN6O |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-3-[11-(4-fluorophenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propan-1-one |
| SMILES | O=C(CCC1=NNC2C3CC(c4ccc(F)cc4)NN3C=CN12)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H33FN6O/c29-23-8-6-22(7-9-23)24-19-25-28-31-30-26(34(28)16-17-35(25)32-24)10-11-27(36)33-14-12-21(13-15-33)18-20-4-2-1-3-5-20/h1-9,16-17,21,24-25,28,31-32H,10-15,18-19H2 |
| InChIKey | QYZHEAUFNZBJLR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |