C26H37N7O3 — CID 53076406
1-[3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanoyl]piperidine-4-carboxamide (PubChem CID 53076406) has the molecular formula C26H37N7O3 and a molecular weight of 495.63 g/mol. Its IUPAC name is 1-[3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53076406 |
| Molecular Formula | C26H37N7O3 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 1-[3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanoyl]piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(C2CC3C4NN=C(CCC(=O)N5CCC(C(N)=O)CC5)N4C=CN3N2)cc1 |
| InChI | InChI=1S/C26H37N7O3/c1-2-3-16-36-20-6-4-18(5-7-20)21-17-22-26-29-28-23(32(26)14-15-33(22)30-21)8-9-24(34)31-12-10-19(11-13-31)25(27)35/h4-7,14-15,19,21-22,26,29-30H,2-3,8-13,16-17H2,1H3,(H2,27,35) |
| InChIKey | JBGDFPAEIAQYFJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|