C20H28N6OS — CID 53038622
N-butyl-2-[[11-(4-methylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide (PubChem CID 53038622) has the molecular formula C20H28N6OS and a molecular weight of 400.55 g/mol. Its IUPAC name is N-butyl-2-[[11-(4-methylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide.
| Compound Name | N-butyl-2-[[11-(4-methylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 53038622 |
| Molecular Formula | C20H28N6OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-butyl-2-[[11-(4-methylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSC1=NNC2C3CC(c4ccc(C)cc4)NN3C=CN12 |
| InChI | InChI=1S/C20H28N6OS/c1-3-4-9-21-18(27)13-28-20-23-22-19-17-12-16(15-7-5-14(2)6-8-15)24-26(17)11-10-25(19)20/h5-8,10-11,16-17,19,22,24H,3-4,9,12-13H2,1-2H3,(H,21,27) |
| InChIKey | USLZJZRJINGJEI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|