C26H30N6O3S — CID 53038800
ethyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 53038800) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is ethyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53038800 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | ethyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSC2=NNC3C4CC(c5cc(C)ccc5C)NN4C=CN23)cc1 |
| InChI | InChI=1S/C26H30N6O3S/c1-4-35-25(34)18-7-9-19(10-8-18)27-23(33)15-36-26-29-28-24-22-14-21(30-32(22)12-11-31(24)26)20-13-16(2)5-6-17(20)3/h5-13,21-22,24,28,30H,4,14-15H2,1-3H3,(H,27,33) |
| InChIKey | MVXXHOBFLFOSNW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |