C25H28N6O3S — CID 53038799
methyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 53038799) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is methyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53038799 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | methyl 4-[[2-[[11-(2,5-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSC2=NNC3C4CC(c5cc(C)ccc5C)NN4C=CN23)cc1 |
| InChI | InChI=1S/C25H28N6O3S/c1-15-4-5-16(2)19(12-15)20-13-21-23-27-28-25(30(23)10-11-31(21)29-20)35-14-22(32)26-18-8-6-17(7-9-18)24(33)34-3/h4-12,20-21,23,27,29H,13-14H2,1-3H3,(H,26,32) |
| InChIKey | VENFONWRYJXNMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |