C28H36N6O3 — CID 53006849
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide (PubChem CID 53006849) has the molecular formula C28H36N6O3 and a molecular weight of 504.64 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide |
|---|---|
| PubChem CID | 53006849 |
| Molecular Formula | C28H36N6O3 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[11-(3,4-dimethylphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCC2=NNC3C4CC(c5ccc(C)c(C)c5)NN4C=CN23)cc1OC |
| InChI | InChI=1S/C28H36N6O3/c1-18-5-7-21(15-19(18)2)22-17-23-28-31-30-26(33(28)13-14-34(23)32-22)9-10-27(35)29-12-11-20-6-8-24(36-3)25(16-20)37-4/h5-8,13-16,22-23,28,31-32H,9-12,17H2,1-4H3,(H,29,35) |
| InChIKey | KUJNSCLRAKJVFV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |