C28H36N6O2 — CID 53076393
3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 53076393) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]-N-[(4-methylphenyl)methyl]propanamide.
| Compound Name | 3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]-N-[(4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 53076393 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 3-[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | CCCCOc1ccc(C2CC3C4NN=C(CCC(=O)NCc5ccc(C)cc5)N4C=CN3N2)cc1 |
| InChI | InChI=1S/C28H36N6O2/c1-3-4-17-36-23-11-9-22(10-12-23)24-18-25-28-31-30-26(33(28)15-16-34(25)32-24)13-14-27(35)29-19-21-7-5-20(2)6-8-21/h5-12,15-16,24-25,28,31-32H,3-4,13-14,17-19H2,1-2H3,(H,29,35) |
| InChIKey | GIJBFOSQAPXLGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|