C25H28F2N6O2S — CID 53038862
2-[[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 53038862) has the molecular formula C25H28F2N6O2S and a molecular weight of 514.60 g/mol. Its IUPAC name is 2-[[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 53038862 |
| Molecular Formula | C25H28F2N6O2S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 2-[[11-(4-butoxyphenyl)-3,4,6,9,10-pentazatricyclo[7.3.0.02,6]dodeca-4,7-dien-5-yl]sulfanyl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CCCCOc1ccc(C2CC3C4NN=C(SCC(=O)Nc5ccc(F)cc5F)N4C=CN3N2)cc1 |
| InChI | InChI=1S/C25H28F2N6O2S/c1-2-3-12-35-18-7-4-16(5-8-18)21-14-22-24-29-30-25(32(24)10-11-33(22)31-21)36-15-23(34)28-20-9-6-17(26)13-19(20)27/h4-11,13,21-22,24,29,31H,2-3,12,14-15H2,1H3,(H,28,34) |
| InChIKey | PJLQGLDXNMRLPM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|